C12H23NO2 — CID 123395458
3,4-dimethoxy-N-methyl-2-methylidene-N-propylpent-3-en-1-amine (PubChem CID 123395458) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 3,4-dimethoxy-N-methyl-2-methylidene-N-propylpent-3-en-1-amine.
| Compound Name | 3,4-dimethoxy-N-methyl-2-methylidene-N-propylpent-3-en-1-amine |
|---|---|
| PubChem CID | 123395458 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 3,4-dimethoxy-N-methyl-2-methylidene-N-propylpent-3-en-1-amine |
| SMILES | C=C(CN(C)CCC)C(OC)=C(C)OC |
| InChI | InChI=1S/C12H23NO2/c1-7-8-13(4)9-10(2)12(15-6)11(3)14-5/h2,7-9H2,1,3-6H3 |
| InChIKey | AAXYPUAAYBOSLL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|