C25H25BrN2O3 — CID 155679556
7-bromo-N-[(4-methoxyphenyl)methyl]-3-[3-(oxan-2-yloxy)prop-1-ynyl]quinolin-4-amine (PubChem CID 155679556) has the molecular formula C25H25BrN2O3 and a molecular weight of 481.39 g/mol. Its IUPAC name is 7-bromo-N-[(4-methoxyphenyl)methyl]-3-[3-(oxan-2-yloxy)prop-1-ynyl]quinolin-4-amine.
| Compound Name | 7-bromo-N-[(4-methoxyphenyl)methyl]-3-[3-(oxan-2-yloxy)prop-1-ynyl]quinolin-4-amine |
|---|---|
| PubChem CID | 155679556 |
| Molecular Formula | C25H25BrN2O3 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 7-bromo-N-[(4-methoxyphenyl)methyl]-3-[3-(oxan-2-yloxy)prop-1-ynyl]quinolin-4-amine |
| SMILES | COc1ccc(CNc2c(C#CCOC3CCCCO3)cnc3cc(Br)ccc23)cc1 |
| InChI | InChI=1S/C25H25BrN2O3/c1-29-21-10-7-18(8-11-21)16-28-25-19(5-4-14-31-24-6-2-3-13-30-24)17-27-23-15-20(26)9-12-22(23)25/h7-12,15,17,24H,2-3,6,13-14,16H2,1H3,(H,27,28) |
| InChIKey | RXPFFYWOFXIXTC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|