C17H14BrClN2O3S — CID 168991112
7-bromo-4-chloro-N-[(4-methoxyphenyl)methyl]quinoline-3-sulfonamide (PubChem CID 168991112) has the molecular formula C17H14BrClN2O3S and a molecular weight of 441.73 g/mol. Its IUPAC name is 7-bromo-4-chloro-N-[(4-methoxyphenyl)methyl]quinoline-3-sulfonamide.
| Compound Name | 7-bromo-4-chloro-N-[(4-methoxyphenyl)methyl]quinoline-3-sulfonamide |
|---|---|
| PubChem CID | 168991112 |
| Molecular Formula | C17H14BrClN2O3S |
| Molecular Weight | 441.73 g/mol |
| Exact Mass | 439.96 |
| IUPAC Name | 7-bromo-4-chloro-N-[(4-methoxyphenyl)methyl]quinoline-3-sulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2cnc3cc(Br)ccc3c2Cl)cc1 |
| InChI | InChI=1S/C17H14BrClN2O3S/c1-24-13-5-2-11(3-6-13)9-21-25(22,23)16-10-20-15-8-12(18)4-7-14(15)17(16)19/h2-8,10,21H,9H2,1H3 |
| InChIKey | AHMUVIHETLOIRN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |