About 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline
7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline (PubChem CID 155679597) has the molecular formula C24H23BrN2O2
and a molecular weight of 451.36 g/mol. Its IUPAC name is 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline.
Molecular Properties
| Compound Name | 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline |
| PubChem CID | 155679597 |
| Molecular Formula | C24H23BrN2O2 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline |
| SMILES | COc1ccc(Cn2c(CC3CCCO3)cc3cnc4cc(Br)ccc4c32)cc1 |
| InChI | InChI=1S/C24H23BrN2O2/c1-28-20-7-4-16(5-8-20)15-27-19(13-21-3-2-10-29-21)11-17-14-26-23-12-18(25)6-9-22(23)24(17)27/h4-9,11-12,14,21H,2-3,10,13,15H2,1H3 |
| InChIKey | PBXXUNJFEZBDNN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline?
The IUPAC name of 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline (CID 155679597) is 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline.
What is the SMILES notation for 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline?
The canonical SMILES for 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline is COc1ccc(Cn2c(CC3CCCO3)cc3cnc4cc(Br)ccc4c32)cc1.
What is the InChIKey of 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline?
The InChIKey is PBXXUNJFEZBDNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23BrN2O2/c1-28-20-7-4-16(5-8-20)15-27-19(13-21-3-2-10-29-21)11-17-14-26-23-12-18(25)6-9-22(23)24(17)27/h4-9,11-12,14,21H,2-3,10,13,15H2,1H3.
What are the key properties of 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline?
7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline has a molecular weight of 451.36 g/mol, XLogP of 5.73, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-[(4-methoxyphenyl)methyl]-2-(oxolan-2-ylmethyl)pyrrolo[3,2-c]quinoline is sourced from PubChem (CID 155679597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).