C24H31N5O4 — CID 155680783
6-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-(2-hydroxyethyl)-1-methyl-6,7,8,9-tetrahydro-5H-carbazole-4-carboxamide (PubChem CID 155680783) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 6-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-(2-hydroxyethyl)-1-methyl-6,7,8,9-tetrahydro-5H-carbazole-4-carboxamide.
| Compound Name | 6-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-(2-hydroxyethyl)-1-methyl-6,7,8,9-tetrahydro-5H-carbazole-4-carboxamide |
|---|---|
| PubChem CID | 155680783 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 6-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-(2-hydroxyethyl)-1-methyl-6,7,8,9-tetrahydro-5H-carbazole-4-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCO)c2c3c([nH]c12)CCC(NC(=O)Nc1cc(C(C)(C)C)on1)C3 |
| InChI | InChI=1S/C24H31N5O4/c1-13-5-7-15(22(31)25-9-10-30)20-16-11-14(6-8-17(16)27-21(13)20)26-23(32)28-19-12-18(33-29-19)24(2,3)4/h5,7,12,14,27,30H,6,8-11H2,1-4H3,(H,25,31)(H2,26,28,29,32) |
| InChIKey | RWDPZWPFSLSSDI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |