C24H31N5O3 — CID 155680827
6-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-propan-2-yl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 155680827) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 6-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-propan-2-yl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | 6-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-propan-2-yl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 155680827 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 6-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-propan-2-yl-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | CC(C)NC(=O)c1ccc2[nH]c3c(c2c1)CC(NC(=O)Nc1cc(C(C)(C)C)on1)CC3 |
| InChI | InChI=1S/C24H31N5O3/c1-13(2)25-22(30)14-6-8-18-16(10-14)17-11-15(7-9-19(17)27-18)26-23(31)28-21-12-20(32-29-21)24(3,4)5/h6,8,10,12-13,15,27H,7,9,11H2,1-5H3,(H,25,30)(H2,26,28,29,31) |
| InChIKey | QFXWLVIHLVJTFL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|