C24H23NO4 — CID 155682286
5-(dibenzylamino)-4,6-dimethylbenzene-1,3-dicarboxylic acid (PubChem CID 155682286) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 5-(dibenzylamino)-4,6-dimethylbenzene-1,3-dicarboxylic acid.
| Compound Name | 5-(dibenzylamino)-4,6-dimethylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 155682286 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 5-(dibenzylamino)-4,6-dimethylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(C(=O)O)cc(C(=O)O)c(C)c1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H23NO4/c1-16-20(23(26)27)13-21(24(28)29)17(2)22(16)25(14-18-9-5-3-6-10-18)15-19-11-7-4-8-12-19/h3-13H,14-15H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | RPIYVMUFERSJEF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |