C15H23BO2 — CID 15568391
diethoxy-[(1S,2S)-2-phenylcyclopentyl]borane (PubChem CID 15568391) has the molecular formula C15H23BO2 and a molecular weight of 246.16 g/mol. Its IUPAC name is diethoxy-[(1S,2S)-2-phenylcyclopentyl]borane.
| Compound Name | diethoxy-[(1S,2S)-2-phenylcyclopentyl]borane |
|---|---|
| PubChem CID | 15568391 |
| Molecular Formula | C15H23BO2 |
| Molecular Weight | 246.16 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | diethoxy-[(1S,2S)-2-phenylcyclopentyl]borane |
| SMILES | CCOB(OCC)[C@H]1CCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H23BO2/c1-3-17-16(18-4-2)15-12-8-11-14(15)13-9-6-5-7-10-13/h5-7,9-10,14-15H,3-4,8,11-12H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | KDVHHKAHELJDSC-CABCVRRESA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.16 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|