C29H31N — CID 155684100
2-ethenyl-1-ethyl-N-[(3Z,6Z)-5-methylnona-1,3,6,8-tetraen-5-yl]-N-phenyl-3H-inden-5-amine (PubChem CID 155684100) has the molecular formula C29H31N and a molecular weight of 393.57 g/mol. Its IUPAC name is 2-ethenyl-1-ethyl-N-[(3Z,6Z)-5-methylnona-1,3,6,8-tetraen-5-yl]-N-phenyl-3H-inden-5-amine.
| Compound Name | 2-ethenyl-1-ethyl-N-[(3Z,6Z)-5-methylnona-1,3,6,8-tetraen-5-yl]-N-phenyl-3H-inden-5-amine |
|---|---|
| PubChem CID | 155684100 |
| Molecular Formula | C29H31N |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 2-ethenyl-1-ethyl-N-[(3Z,6Z)-5-methylnona-1,3,6,8-tetraen-5-yl]-N-phenyl-3H-inden-5-amine |
| SMILES | C=C/C=C\C(C)(/C=C\C=C)N(c1ccccc1)c1ccc2c(c1)CC(C=C)=C2CC |
| InChI | InChI=1S/C29H31N/c1-6-10-19-29(5,20-11-7-2)30(25-15-13-12-14-16-25)26-17-18-28-24(22-26)21-23(8-3)27(28)9-4/h6-8,10-20,22H,1-3,9,21H2,4-5H3/b19-10-,20-11- |
| InChIKey | LKEWQXLBQHTCQU-PZRYXVKFSA-N |
| XLogP | 7.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|