C47H46N2 — CID 71177671
12-ethyl-8,8-dimethyl-N,N-diphenyl-5-[2-(N-phenylanilino)butan-2-yl]tetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),3,5,10,14-hexaen-12-amine (PubChem CID 71177671) has the molecular formula C47H46N2 and a molecular weight of 638.90 g/mol. Its IUPAC name is 12-ethyl-8,8-dimethyl-N,N-diphenyl-5-[2-(N-phenylanilino)butan-2-yl]tetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),3,5,10,14-hexaen-12-amine.
| Compound Name | 12-ethyl-8,8-dimethyl-N,N-diphenyl-5-[2-(N-phenylanilino)butan-2-yl]tetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),3,5,10,14-hexaen-12-amine |
|---|---|
| PubChem CID | 71177671 |
| Molecular Formula | C47H46N2 |
| Molecular Weight | 638.90 g/mol |
| Exact Mass | 638.37 |
| IUPAC Name | 12-ethyl-8,8-dimethyl-N,N-diphenyl-5-[2-(N-phenylanilino)butan-2-yl]tetracyclo[7.6.0.02,7.011,14]pentadeca-1(9),2(7),3,5,10,14-hexaen-12-amine |
| SMILES | CCC(C)(c1ccc2c(c1)C(C)(C)c1cc3c(cc1-2)CC3(CC)N(c1ccccc1)c1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C47H46N2/c1-6-46(5,48(36-20-12-8-13-21-36)37-22-14-9-15-23-37)35-28-29-40-41-30-34-33-47(7-2,42(34)32-44(41)45(3,4)43(40)31-35)49(38-24-16-10-17-25-38)39-26-18-11-19-27-39/h8-32H,6-7,33H2,1-5H3 |
| InChIKey | SIIWGIZIVZJXTB-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.90 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |