C19H29BF3O — CID 155684940
CID 155684940 (PubChem CID 155684940) has the molecular formula C19H29BF3O and a molecular weight of 341.25 g/mol.
| Compound Name | CID 155684940 |
|---|---|
| PubChem CID | 155684940 |
| Molecular Formula | C19H29BF3O |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | — |
| SMILES | CCC(C)C(C)C.CCC([B]C(C)=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13BF3O.C7H16/c1-3-11(13-8(2)17)9-4-6-10(7-5-9)12(14,15)16;1-5-7(4)6(2)3/h4-7,11H,3H2,1-2H3;6-7H,5H2,1-4H3 |
| InChIKey | WLTCRGHPLWOPEB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|