C27H36N2O4 — CID 155685371
[6-(diethylaminomethyl)naphthalen-2-yl]methyl carbamate;ethane;4-methylbenzoic acid (PubChem CID 155685371) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is [6-(diethylaminomethyl)naphthalen-2-yl]methyl carbamate;ethane;4-methylbenzoic acid.
| Compound Name | [6-(diethylaminomethyl)naphthalen-2-yl]methyl carbamate;ethane;4-methylbenzoic acid |
|---|---|
| PubChem CID | 155685371 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | [6-(diethylaminomethyl)naphthalen-2-yl]methyl carbamate;ethane;4-methylbenzoic acid |
| SMILES | CC.CCN(CC)Cc1ccc2cc(COC(N)=O)ccc2c1.Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H22N2O2.C8H8O2.C2H6/c1-3-19(4-2)11-13-5-7-16-10-14(12-21-17(18)20)6-8-15(16)9-13;1-6-2-4-7(5-3-6)8(9)10;1-2/h5-10H,3-4,11-12H2,1-2H3,(H2,18,20);2-5H,1H3,(H,9,10);1-2H3 |
| InChIKey | JTYAQXOCTDGQRE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |