C9H13ClN2 — CID 155686934
2-chloro-4,5-diethyl-6-methylpyrimidine (PubChem CID 155686934) has the molecular formula C9H13ClN2 and a molecular weight of 184.67 g/mol. Its IUPAC name is 2-chloro-4,5-diethyl-6-methylpyrimidine.
| Compound Name | 2-chloro-4,5-diethyl-6-methylpyrimidine |
|---|---|
| PubChem CID | 155686934 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-chloro-4,5-diethyl-6-methylpyrimidine |
| SMILES | CCc1nc(Cl)nc(C)c1CC |
| InChI | InChI=1S/C9H13ClN2/c1-4-7-6(3)11-9(10)12-8(7)5-2/h4-5H2,1-3H3 |
| InChIKey | JAGSFCNHTCQZQN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |