C8H11K — CID 155693270
potassium 5-methylidenehepta-1,3-diene (PubChem CID 155693270) has the molecular formula C8H11K and a molecular weight of 146.27 g/mol. Its IUPAC name is potassium 5-methylidenehepta-1,3-diene.
| Compound Name | potassium 5-methylidenehepta-1,3-diene |
|---|---|
| PubChem CID | 155693270 |
| Molecular Formula | C8H11K |
| Molecular Weight | 146.27 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | potassium 5-methylidenehepta-1,3-diene |
| SMILES | C=C/[C-]=C/C(=C)CC.[K+] |
| InChI | InChI=1S/C8H11.K/c1-4-6-7-8(3)5-2;/h4,7H,1,3,5H2,2H3;/q-1;+1 |
| InChIKey | FCFXPGVZRYSTRV-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.27 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|