C14H29NO6 — CID 155693483
2-methoxy-2-methylpropane;methyl 2-formamido-4-(3-hydroxypropoxy)butanoate (PubChem CID 155693483) has the molecular formula C14H29NO6 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-methoxy-2-methylpropane;methyl 2-formamido-4-(3-hydroxypropoxy)butanoate.
| Compound Name | 2-methoxy-2-methylpropane;methyl 2-formamido-4-(3-hydroxypropoxy)butanoate |
|---|---|
| PubChem CID | 155693483 |
| Molecular Formula | C14H29NO6 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-methoxy-2-methylpropane;methyl 2-formamido-4-(3-hydroxypropoxy)butanoate |
| SMILES | COC(=O)C(CCOCCCO)NC=O.COC(C)(C)C |
| InChI | InChI=1S/C9H17NO5.C5H12O/c1-14-9(13)8(10-7-12)3-6-15-5-2-4-11;1-5(2,3)6-4/h7-8,11H,2-6H2,1H3,(H,10,12);1-4H3 |
| InChIKey | QSOUWQCEZGPOCG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|