C22H37FN4O3 — CID 155694898
tert-butyl (5R)-5-[(3-amino-2-fluorophenyl)-hydroxymethyl]-2,2-dimethylpyrrolidine-1-carboxylate;pyrrolidin-1-amine (PubChem CID 155694898) has the molecular formula C22H37FN4O3 and a molecular weight of 424.56 g/mol. Its IUPAC name is tert-butyl (5R)-5-[(3-amino-2-fluorophenyl)-hydroxymethyl]-2,2-dimethylpyrrolidine-1-carboxylate;pyrrolidin-1-amine.
| Compound Name | tert-butyl (5R)-5-[(3-amino-2-fluorophenyl)-hydroxymethyl]-2,2-dimethylpyrrolidine-1-carboxylate;pyrrolidin-1-amine |
|---|---|
| PubChem CID | 155694898 |
| Molecular Formula | C22H37FN4O3 |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | tert-butyl (5R)-5-[(3-amino-2-fluorophenyl)-hydroxymethyl]-2,2-dimethylpyrrolidine-1-carboxylate;pyrrolidin-1-amine |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](C(O)c2cccc(N)c2F)CCC1(C)C.NN1CCCC1 |
| InChI | InChI=1S/C18H27FN2O3.C4H10N2/c1-17(2,3)24-16(23)21-13(9-10-18(21,4)5)15(22)11-7-6-8-12(20)14(11)19;5-6-3-1-2-4-6/h6-8,13,15,22H,9-10,20H2,1-5H3;1-5H2/t13-,15?;/m1./s1 |
| InChIKey | YORMGMDNJHLLAE-LKNSGBSQSA-N |
| XLogP | 3.58 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|