C22H34N4O3 — CID 164771704
tert-butyl (5R)-5-[(R)-hydroxy-[3-(pyrrolidin-1-yldiazenyl)phenyl]methyl]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 164771704) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is tert-butyl (5R)-5-[(R)-hydroxy-[3-(pyrrolidin-1-yldiazenyl)phenyl]methyl]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5R)-5-[(R)-hydroxy-[3-(pyrrolidin-1-yldiazenyl)phenyl]methyl]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164771704 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | tert-butyl (5R)-5-[(R)-hydroxy-[3-(pyrrolidin-1-yldiazenyl)phenyl]methyl]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]([C@H](O)c2cccc(/N=N/N3CCCC3)c2)CCC1(C)C |
| InChI | InChI=1S/C22H34N4O3/c1-21(2,3)29-20(28)26-18(11-12-22(26,4)5)19(27)16-9-8-10-17(15-16)23-24-25-13-6-7-14-25/h8-10,15,18-19,27H,6-7,11-14H2,1-5H3/b24-23+/t18-,19-/m1/s1 |
| InChIKey | LLAAKWJULFTUGC-VGNRAUNXSA-N |
| XLogP | 4.99 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|