C23H29ClN2S — CID 155697049
N-(4-aminophenyl)sulfanyl-2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)aniline (PubChem CID 155697049) has the molecular formula C23H29ClN2S and a molecular weight of 401.02 g/mol. Its IUPAC name is N-(4-aminophenyl)sulfanyl-2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)aniline.
| Compound Name | N-(4-aminophenyl)sulfanyl-2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)aniline |
|---|---|
| PubChem CID | 155697049 |
| Molecular Formula | C23H29ClN2S |
| Molecular Weight | 401.02 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-(4-aminophenyl)sulfanyl-2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)aniline |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(NSc3ccc(N)cc3)c(Cl)c1)C2 |
| InChI | InChI=1S/C23H29ClN2S/c1-15-9-16-11-17(10-15)14-23(2,13-16)18-3-8-22(21(24)12-18)26-27-20-6-4-19(25)5-7-20/h3-8,12,15-17,26H,9-11,13-14,25H2,1-2H3 |
| InChIKey | IGVKDERKIYVGDQ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.02 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|