C26H35ClN2OS — CID 155697099
N-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]sulfanylphenyl]formamide;ethane (PubChem CID 155697099) has the molecular formula C26H35ClN2OS and a molecular weight of 459.10 g/mol. Its IUPAC name is N-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]sulfanylphenyl]formamide;ethane.
| Compound Name | N-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]sulfanylphenyl]formamide;ethane |
|---|---|
| PubChem CID | 155697099 |
| Molecular Formula | C26H35ClN2OS |
| Molecular Weight | 459.10 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | N-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]sulfanylphenyl]formamide;ethane |
| SMILES | CC.CC1CC2CC(C1)CC(C)(c1ccc(NSc3ccc(NC=O)cc3)c(Cl)c1)C2 |
| InChI | InChI=1S/C24H29ClN2OS.C2H6/c1-16-9-17-11-18(10-16)14-24(2,13-17)19-3-8-23(22(25)12-19)27-29-21-6-4-20(5-7-21)26-15-28;1-2/h3-8,12,15-18,27H,9-11,13-14H2,1-2H3,(H,26,28);1-2H3 |
| InChIKey | HREZREPDGBMARS-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.10 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|