C24H29ClN2OS — CID 155697100
N-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]sulfanylphenyl]formamide (PubChem CID 155697100) has the molecular formula C24H29ClN2OS and a molecular weight of 429.03 g/mol. Its IUPAC name is N-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]sulfanylphenyl]formamide.
| Compound Name | N-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]sulfanylphenyl]formamide |
|---|---|
| PubChem CID | 155697100 |
| Molecular Formula | C24H29ClN2OS |
| Molecular Weight | 429.03 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]sulfanylphenyl]formamide |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(NSc3ccc(NC=O)cc3)c(Cl)c1)C2 |
| InChI | InChI=1S/C24H29ClN2OS/c1-16-9-17-11-18(10-16)14-24(2,13-17)19-3-8-23(22(25)12-19)27-29-21-6-4-20(5-7-21)26-15-28/h3-8,12,15-18,27H,9-11,13-14H2,1-2H3,(H,26,28) |
| InChIKey | OAKAUKMDZJCLDB-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.03 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|