C25H33ClN2S — CID 155697013
N-(4-aminophenyl)sulfanyl-2-chloro-4-(1,3,5,7-tetramethyl-3-bicyclo[3.3.1]nonanyl)aniline (PubChem CID 155697013) has the molecular formula C25H33ClN2S and a molecular weight of 429.07 g/mol. Its IUPAC name is N-(4-aminophenyl)sulfanyl-2-chloro-4-(1,3,5,7-tetramethyl-3-bicyclo[3.3.1]nonanyl)aniline.
| Compound Name | N-(4-aminophenyl)sulfanyl-2-chloro-4-(1,3,5,7-tetramethyl-3-bicyclo[3.3.1]nonanyl)aniline |
|---|---|
| PubChem CID | 155697013 |
| Molecular Formula | C25H33ClN2S |
| Molecular Weight | 429.07 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-(4-aminophenyl)sulfanyl-2-chloro-4-(1,3,5,7-tetramethyl-3-bicyclo[3.3.1]nonanyl)aniline |
| SMILES | CC1CC2(C)CC(C)(C1)CC(C)(c1ccc(NSc3ccc(N)cc3)c(Cl)c1)C2 |
| InChI | InChI=1S/C25H33ClN2S/c1-17-12-23(2)14-24(3,13-17)16-25(4,15-23)18-5-10-22(21(26)11-18)28-29-20-8-6-19(27)7-9-20/h5-11,17,28H,12-16,27H2,1-4H3 |
| InChIKey | VZZXCQXQVOGRLJ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.07 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|