C30H34ClN3O — CID 155697309
2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]-N-methylanilino]pyridine-3-carbaldehyde (PubChem CID 155697309) has the molecular formula C30H34ClN3O and a molecular weight of 488.08 g/mol. Its IUPAC name is 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]-N-methylanilino]pyridine-3-carbaldehyde.
| Compound Name | 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]-N-methylanilino]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 155697309 |
| Molecular Formula | C30H34ClN3O |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]-N-methylanilino]pyridine-3-carbaldehyde |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(Nc3ccc(N(C)c4ncccc4C=O)cc3)c(Cl)c1)C2 |
| InChI | InChI=1S/C30H34ClN3O/c1-20-13-21-15-22(14-20)18-30(2,17-21)24-6-11-28(27(31)16-24)33-25-7-9-26(10-8-25)34(3)29-23(19-35)5-4-12-32-29/h4-12,16,19-22,33H,13-15,17-18H2,1-3H3 |
| InChIKey | ICODIIOIQJPROT-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|