C34H36F4N6O2S — CID 155697885
[(E)-1-aminobut-1-enyl] 5-(2-ethylpyrimidin-5-yl)-2-(trifluoromethyl)-1,3-thiazole-4-carboximidate;N-[2-fluoro-6-(1-phenylethenyl)phenyl]pentanamide (PubChem CID 155697885) has the molecular formula C34H36F4N6O2S and a molecular weight of 668.76 g/mol. Its IUPAC name is [(E)-1-aminobut-1-enyl] 5-(2-ethylpyrimidin-5-yl)-2-(trifluoromethyl)-1,3-thiazole-4-carboximidate;N-[2-fluoro-6-(1-phenylethenyl)phenyl]pentanamide.
| Compound Name | [(E)-1-aminobut-1-enyl] 5-(2-ethylpyrimidin-5-yl)-2-(trifluoromethyl)-1,3-thiazole-4-carboximidate;N-[2-fluoro-6-(1-phenylethenyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 155697885 |
| Molecular Formula | C34H36F4N6O2S |
| Molecular Weight | 668.76 g/mol |
| Exact Mass | 668.26 |
| IUPAC Name | [(E)-1-aminobut-1-enyl] 5-(2-ethylpyrimidin-5-yl)-2-(trifluoromethyl)-1,3-thiazole-4-carboximidate;N-[2-fluoro-6-(1-phenylethenyl)phenyl]pentanamide |
| SMILES | C=C(c1ccccc1)c1cccc(F)c1NC(=O)CCCC.[H]/N=C(\O/C(N)=C/CC)c1nc(C(F)(F)F)sc1-c1cnc(CC)nc1 |
| InChI | InChI=1S/C19H20FNO.C15H16F3N5OS/c1-3-4-13-18(22)21-19-16(11-8-12-17(19)20)14(2)15-9-6-5-7-10-15;1-3-5-9(19)24-13(20)11-12(25-14(23-11)15(16,17)18)8-6-21-10(4-2)22-7-8/h5-12H,2-4,13H2,1H3,(H,21,22);5-7,20H,3-4,19H2,1-2H3/b;9-5+,20-13- |
| InChIKey | UXQAZGVKBPPLTJ-PLBGEPMQSA-N |
| XLogP | 8.75 |
| TPSA | 126.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.76 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|