C19H16FN5O3+ — CID 155699988
CID 155699988 (PubChem CID 155699988) has the molecular formula C19H16FN5O3+ and a molecular weight of 381.37 g/mol.
| Compound Name | CID 155699988 |
|---|---|
| PubChem CID | 155699988 |
| Molecular Formula | C19H16FN5O3+ |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | — |
| SMILES | C[N+]1=NC(C(=O)Nc2ccc(OCc3cc(F)cc(C#N)c3)cn2)=C[CH]C1=O.[H][H] |
| InChI | InChI=1S/C19H13FN5O3.H2/c1-25-18(26)5-3-16(24-25)19(27)23-17-4-2-15(10-22-17)28-11-13-6-12(9-21)7-14(20)8-13;/h2-8,10H,11H2,1H3;1H/p+1 |
| InChIKey | RZYFYJJDVRYDBH-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|