C23H27BClF3INO3 — CID 155701604
CID 155701604 (PubChem CID 155701604) has the molecular formula C23H27BClF3INO3 and a molecular weight of 595.64 g/mol.
| Compound Name | CID 155701604 |
|---|---|
| PubChem CID | 155701604 |
| Molecular Formula | C23H27BClF3INO3 |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.08 |
| IUPAC Name | — |
| SMILES | CC.O=C(NC1CCCC(O)C1)c1cccc(COc2ccc(C(F)(F)F)cc2Cl)c1.[B]I |
| InChI | InChI=1S/C21H21ClF3NO3.C2H6.BI/c22-18-10-15(21(23,24)25)7-8-19(18)29-12-13-3-1-4-14(9-13)20(28)26-16-5-2-6-17(27)11-16;2*1-2/h1,3-4,7-10,16-17,27H,2,5-6,11-12H2,(H,26,28);1-2H3; |
| InChIKey | XDHNUBFCTUPMNC-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|