C27H48O2S — CID 155703031
tert-butyl acetate;2-butyl-1-methyl-2-propyl-1,3-dihydroindene;2-methylpropane-2-thiol (PubChem CID 155703031) has the molecular formula C27H48O2S and a molecular weight of 436.75 g/mol. Its IUPAC name is tert-butyl acetate;2-butyl-1-methyl-2-propyl-1,3-dihydroindene;2-methylpropane-2-thiol.
| Compound Name | tert-butyl acetate;2-butyl-1-methyl-2-propyl-1,3-dihydroindene;2-methylpropane-2-thiol |
|---|---|
| PubChem CID | 155703031 |
| Molecular Formula | C27H48O2S |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | tert-butyl acetate;2-butyl-1-methyl-2-propyl-1,3-dihydroindene;2-methylpropane-2-thiol |
| SMILES | CC(=O)OC(C)(C)C.CC(C)(C)S.CCCCC1(CCC)Cc2ccccc2C1C |
| InChI | InChI=1S/C17H26.C6H12O2.C4H10S/c1-4-6-12-17(11-5-2)13-15-9-7-8-10-16(15)14(17)3;1-5(7)8-6(2,3)4;1-4(2,3)5/h7-10,14H,4-6,11-13H2,1-3H3;1-4H3;5H,1-3H3 |
| InChIKey | DJFOATCYGICTNG-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|