C31H54 — CID 155703087
ethane;17-[(E)-4-ethyl-5-methylhex-2-enyl]-9,10,13-trimethyl-1,2,3,4,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 155703087) has the molecular formula C31H54 and a molecular weight of 426.77 g/mol. Its IUPAC name is ethane;17-[(E)-4-ethyl-5-methylhex-2-enyl]-9,10,13-trimethyl-1,2,3,4,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | ethane;17-[(E)-4-ethyl-5-methylhex-2-enyl]-9,10,13-trimethyl-1,2,3,4,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 155703087 |
| Molecular Formula | C31H54 |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 426.42 |
| IUPAC Name | ethane;17-[(E)-4-ethyl-5-methylhex-2-enyl]-9,10,13-trimethyl-1,2,3,4,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | CC.CCC(/C=C/CC1CCC2C3CC=C4CCCCC4(C)C3(C)CCC12C)C(C)C |
| InChI | InChI=1S/C29H48.C2H6/c1-7-22(21(2)3)11-10-13-23-14-16-25-26-17-15-24-12-8-9-18-28(24,5)29(26,6)20-19-27(23,25)4;1-2/h10-11,15,21-23,25-26H,7-9,12-14,16-20H2,1-6H3;1-2H3/b11-10+; |
| InChIKey | QFWMOANARZSRCF-ASTDGNLGSA-N |
| XLogP | 10.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|