C35H60O2 — CID 178009819
ethane;[17-[(E)-4-ethyl-5-methylhex-2-enyl]-8,10,13-trimethyl-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-methylpropanoate (PubChem CID 178009819) has the molecular formula C35H60O2 and a molecular weight of 512.86 g/mol. Its IUPAC name is ethane;[17-[(E)-4-ethyl-5-methylhex-2-enyl]-8,10,13-trimethyl-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-methylpropanoate.
| Compound Name | ethane;[17-[(E)-4-ethyl-5-methylhex-2-enyl]-8,10,13-trimethyl-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 178009819 |
| Molecular Formula | C35H60O2 |
| Molecular Weight | 512.86 g/mol |
| Exact Mass | 512.46 |
| IUPAC Name | ethane;[17-[(E)-4-ethyl-5-methylhex-2-enyl]-8,10,13-trimethyl-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-methylpropanoate |
| SMILES | CC.CCC(/C=C/CC1CCC2C1(C)CCC1C3(C)CCC(OC(=O)C(C)C)CC3=CCC12C)C(C)C |
| InChI | InChI=1S/C33H54O2.C2H6/c1-9-24(22(2)3)11-10-12-25-13-14-28-31(25,6)20-17-29-32(7)19-16-27(35-30(34)23(4)5)21-26(32)15-18-33(28,29)8;1-2/h10-11,15,22-25,27-29H,9,12-14,16-21H2,1-8H3;1-2H3/b11-10+; |
| InChIKey | ZADLFXZZBYXXEE-ASTDGNLGSA-N |
| XLogP | 10.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.86 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|