C32H53NO3 — CID 166045562
[(3S,8S,9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-amino-4-oxobutanoate (PubChem CID 166045562) has the molecular formula C32H53NO3 and a molecular weight of 499.78 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-amino-4-oxobutanoate.
| Compound Name | [(3S,8S,9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-amino-4-oxobutanoate |
|---|---|
| PubChem CID | 166045562 |
| Molecular Formula | C32H53NO3 |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 499.40 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-amino-4-oxobutanoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@@]2(C)CC=C2C[C@@H](OC(=O)CCC(N)=O)CC[C@@]21C |
| InChI | InChI=1S/C32H53NO3/c1-21(2)8-7-9-22(3)25-10-11-26-31(25,5)19-16-27-30(4)18-15-24(36-29(35)13-12-28(33)34)20-23(30)14-17-32(26,27)6/h14,21-22,24-27H,7-13,15-20H2,1-6H3,(H2,33,34)/t22-,24+,25-,26-,27-,30+,31-,32+/m1/s1 |
| InChIKey | OGRPELSHJRMTJK-VSEJPEHLSA-N |
| XLogP | 7.60 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|