C31H53NO2 — CID 177154522
[(9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-aminopropanoate (PubChem CID 177154522) has the molecular formula C31H53NO2 and a molecular weight of 471.77 g/mol. Its IUPAC name is [(9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-aminopropanoate.
| Compound Name | [(9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-aminopropanoate |
|---|---|
| PubChem CID | 177154522 |
| Molecular Formula | C31H53NO2 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 471.41 |
| IUPAC Name | [(9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3-aminopropanoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3(C)CC=C4CC(OC(=O)CCN)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H53NO2/c1-21(2)8-7-9-22(3)25-10-11-26-30(25,5)18-14-27-29(4)17-13-24(34-28(33)15-19-32)20-23(29)12-16-31(26,27)6/h12,21-22,24-27H,7-11,13-20,32H2,1-6H3/t22-,24?,25-,26-,27-,29+,30-,31?/m1/s1 |
| InChIKey | LAOADWRALXEEAM-SZGDECGRSA-N |
| XLogP | 7.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|