C33H58 — CID 176556647
(3R,8S,9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-3-pentyl-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 176556647) has the molecular formula C33H58 and a molecular weight of 454.83 g/mol. Its IUPAC name is (3R,8S,9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-3-pentyl-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (3R,8S,9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-3-pentyl-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 176556647 |
| Molecular Formula | C33H58 |
| Molecular Weight | 454.83 g/mol |
| Exact Mass | 454.45 |
| IUPAC Name | (3R,8S,9S,10R,13R,14R,17R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-3-pentyl-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | CCCCC[C@@H]1CC[C@@]2(C)C(=CC[C@@]3(C)[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C33H58/c1-8-9-10-14-26-17-20-31(5)27(23-26)18-21-33(7)29-16-15-28(25(4)13-11-12-24(2)3)32(29,6)22-19-30(31)33/h18,24-26,28-30H,8-17,19-23H2,1-7H3/t25-,26-,28-,29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | VIZGHMIHGGGKAX-ZVCFCOTHSA-N |
| XLogP | 10.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.83 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|