C29H47ClO2 — CID 88887236
[(8S,9S,10R,13R,14R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] carbonochloridate (PubChem CID 88887236) has the molecular formula C29H47ClO2 and a molecular weight of 463.15 g/mol. Its IUPAC name is [(8S,9S,10R,13R,14R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] carbonochloridate.
| Compound Name | [(8S,9S,10R,13R,14R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] carbonochloridate |
|---|---|
| PubChem CID | 88887236 |
| Molecular Formula | C29H47ClO2 |
| Molecular Weight | 463.15 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | [(8S,9S,10R,13R,14R)-8,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] carbonochloridate |
| SMILES | CC(C)CCC[C@@H](C)C1CC[C@H]2[C@]3(C)CC=C4CC(OC(=O)Cl)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H47ClO2/c1-19(2)8-7-9-20(3)23-10-11-24-28(23,5)17-14-25-27(4)16-13-22(32-26(30)31)18-21(27)12-15-29(24,25)6/h12,19-20,22-25H,7-11,13-18H2,1-6H3/t20-,22?,23?,24-,25-,27+,28-,29+/m1/s1 |
| InChIKey | AKURBGWGEDESIC-MVBOJUPPSA-N |
| XLogP | 9.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.15 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|