C35H58N2O2 — CID 168884085
[(3S,9R,10R,13R,14R,17R)-8-amino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 1-azabicyclo[2.2.2]octane-3-carboxylate (PubChem CID 168884085) has the molecular formula C35H58N2O2 and a molecular weight of 538.86 g/mol. Its IUPAC name is [(3S,9R,10R,13R,14R,17R)-8-amino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 1-azabicyclo[2.2.2]octane-3-carboxylate.
| Compound Name | [(3S,9R,10R,13R,14R,17R)-8-amino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 1-azabicyclo[2.2.2]octane-3-carboxylate |
|---|---|
| PubChem CID | 168884085 |
| Molecular Formula | C35H58N2O2 |
| Molecular Weight | 538.86 g/mol |
| Exact Mass | 538.45 |
| IUPAC Name | [(3S,9R,10R,13R,14R,17R)-8-amino-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 1-azabicyclo[2.2.2]octane-3-carboxylate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3(N)CC=C4C[C@@H](OC(=O)C5CN6CCC5CC6)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H58N2O2/c1-23(2)7-6-8-24(3)29-9-10-30-34(29,5)17-13-31-33(4)16-12-27(21-26(33)11-18-35(30,31)36)39-32(38)28-22-37-19-14-25(28)15-20-37/h11,23-25,27-31H,6-10,12-22,36H2,1-5H3/t24-,27+,28?,29-,30-,31-,33+,34-,35?/m1/s1 |
| InChIKey | HBXUCTDKAMSOCU-PWBPXSBESA-N |
| XLogP | 7.36 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.86 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|