C36H65NO2 — CID 155199640
3-[2-[(2S)-3,3-dimethylpentan-2-yl]oxyethoxy]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-8-amine (PubChem CID 155199640) has the molecular formula C36H65NO2 and a molecular weight of 543.92 g/mol. Its IUPAC name is 3-[2-[(2S)-3,3-dimethylpentan-2-yl]oxyethoxy]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-8-amine.
| Compound Name | 3-[2-[(2S)-3,3-dimethylpentan-2-yl]oxyethoxy]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-8-amine |
|---|---|
| PubChem CID | 155199640 |
| Molecular Formula | C36H65NO2 |
| Molecular Weight | 543.92 g/mol |
| Exact Mass | 543.50 |
| IUPAC Name | 3-[2-[(2S)-3,3-dimethylpentan-2-yl]oxyethoxy]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-8-amine |
| SMILES | CCC(C)(C)[C@H](C)OCCOC1CCC2(C)C(=CCC3(N)C2CCC2(C)C([C@H](C)CCCC(C)C)CCC23)C1 |
| InChI | InChI=1S/C36H65NO2/c1-10-33(6,7)27(5)38-22-23-39-29-17-19-34(8)28(24-29)16-21-36(37)31-15-14-30(26(4)13-11-12-25(2)3)35(31,9)20-18-32(34)36/h16,25-27,29-32H,10-15,17-24,37H2,1-9H3/t26-,27+,29?,30?,31?,32?,34?,35?,36?/m1/s1 |
| InChIKey | HMJUUOMMHSBDSS-SMTVDYKISA-N |
| XLogP | 9.34 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.92 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|