C43H77NO3 — CID 171659206
[(9R,14S)-8-ethyl-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] N-[3-(3,3-dimethylhexoxy)-3-methylbutyl]carbamate (PubChem CID 171659206) has the molecular formula C43H77NO3 and a molecular weight of 656.09 g/mol. Its IUPAC name is [(9R,14S)-8-ethyl-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] N-[3-(3,3-dimethylhexoxy)-3-methylbutyl]carbamate.
| Compound Name | [(9R,14S)-8-ethyl-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] N-[3-(3,3-dimethylhexoxy)-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 171659206 |
| Molecular Formula | C43H77NO3 |
| Molecular Weight | 656.09 g/mol |
| Exact Mass | 655.59 |
| IUPAC Name | [(9R,14S)-8-ethyl-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,3,4,7,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] N-[3-(3,3-dimethylhexoxy)-3-methylbutyl]carbamate |
| SMILES | CCCC(C)(C)CCOC(C)(C)CCNC(=O)OC1CCC2(C)C(=CCC3(CC)[C@H]2CCC2(C)C([C@@H](C)CCCC(C)C)CC[C@@H]23)C1 |
| InChI | InChI=1S/C43H77NO3/c1-12-22-39(6,7)27-29-46-40(8,9)26-28-44-38(45)47-34-20-23-41(10)33(30-34)19-25-43(13-2)36-18-17-35(32(5)16-14-15-31(3)4)42(36,11)24-21-37(41)43/h19,31-32,34-37H,12-18,20-30H2,1-11H3,(H,44,45)/t32-,34?,35?,36-,37-,41?,42?,43?/m0/s1 |
| InChIKey | RVDKVOKISGWODW-FYJIZDAQSA-N |
| XLogP | 12.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.09 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|