C12H18N4O2S2 — CID 155704930
3-(2-methoxyethyl)-1-methyl-8-propylsulfanyl-6-sulfanylidene-7H-purin-2-one (PubChem CID 155704930) has the molecular formula C12H18N4O2S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-1-methyl-8-propylsulfanyl-6-sulfanylidene-7H-purin-2-one.
| Compound Name | 3-(2-methoxyethyl)-1-methyl-8-propylsulfanyl-6-sulfanylidene-7H-purin-2-one |
|---|---|
| PubChem CID | 155704930 |
| Molecular Formula | C12H18N4O2S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-(2-methoxyethyl)-1-methyl-8-propylsulfanyl-6-sulfanylidene-7H-purin-2-one |
| SMILES | CCCSc1nc2c([nH]1)c(=S)n(C)c(=O)n2CCOC |
| InChI | InChI=1S/C12H18N4O2S2/c1-4-7-20-11-13-8-9(14-11)16(5-6-18-3)12(17)15(2)10(8)19/h4-7H2,1-3H3,(H,13,14) |
| InChIKey | AAFUBIYFGYIDOC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|