C12H16N4O2S2 — CID 98170604
1,3-dimethyl-8-[[(2S)-oxolan-2-yl]methylsulfanyl]-6-sulfanylidene-7H-purin-2-one (PubChem CID 98170604) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 1,3-dimethyl-8-[[(2S)-oxolan-2-yl]methylsulfanyl]-6-sulfanylidene-7H-purin-2-one.
| Compound Name | 1,3-dimethyl-8-[[(2S)-oxolan-2-yl]methylsulfanyl]-6-sulfanylidene-7H-purin-2-one |
|---|---|
| PubChem CID | 98170604 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 1,3-dimethyl-8-[[(2S)-oxolan-2-yl]methylsulfanyl]-6-sulfanylidene-7H-purin-2-one |
| SMILES | Cn1c(=S)c2[nH]c(SC[C@@H]3CCCO3)nc2n(C)c1=O |
| InChI | InChI=1S/C12H16N4O2S2/c1-15-9-8(10(19)16(2)12(15)17)13-11(14-9)20-6-7-4-3-5-18-7/h7H,3-6H2,1-2H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | SXLIZCRHKYNSMR-ZETCQYMHSA-N |
| XLogP | 1.60 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|