C11H17N5O3 — CID 82465014
8-(ethylamino)-3-(2-methoxyethyl)-1-methyl-7H-purine-2,6-dione (PubChem CID 82465014) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 8-(ethylamino)-3-(2-methoxyethyl)-1-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(ethylamino)-3-(2-methoxyethyl)-1-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 82465014 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 8-(ethylamino)-3-(2-methoxyethyl)-1-methyl-7H-purine-2,6-dione |
| SMILES | CCNc1nc2c([nH]1)c(=O)n(C)c(=O)n2CCOC |
| InChI | InChI=1S/C11H17N5O3/c1-4-12-10-13-7-8(14-10)16(5-6-19-3)11(18)15(2)9(7)17/h4-6H2,1-3H3,(H2,12,13,14) |
| InChIKey | WJURUADLMBIKEP-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |