C29H35FN6O4 — CID 155705553
pentyl N-[7-[2-[(1S,2R,3S,4S)-4-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3-dihydroxy-1-methylcyclopentyl]ethyl]quinolin-2-yl]carbamate (PubChem CID 155705553) has the molecular formula C29H35FN6O4 and a molecular weight of 550.64 g/mol. Its IUPAC name is pentyl N-[7-[2-[(1S,2R,3S,4S)-4-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3-dihydroxy-1-methylcyclopentyl]ethyl]quinolin-2-yl]carbamate.
| Compound Name | pentyl N-[7-[2-[(1S,2R,3S,4S)-4-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3-dihydroxy-1-methylcyclopentyl]ethyl]quinolin-2-yl]carbamate |
|---|---|
| PubChem CID | 155705553 |
| Molecular Formula | C29H35FN6O4 |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | pentyl N-[7-[2-[(1S,2R,3S,4S)-4-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2,3-dihydroxy-1-methylcyclopentyl]ethyl]quinolin-2-yl]carbamate |
| SMILES | CCCCCOC(=O)Nc1ccc2ccc(CC[C@@]3(C)C[C@@H](c4cc(F)c5c(N)ncnn45)[C@H](O)[C@@H]3O)cc2n1 |
| InChI | InChI=1S/C29H35FN6O4/c1-3-4-5-12-40-28(39)35-23-9-8-18-7-6-17(13-21(18)34-23)10-11-29(2)15-19(25(37)26(29)38)22-14-20(30)24-27(31)32-16-33-36(22)24/h6-9,13-14,16,19,25-26,37-38H,3-5,10-12,15H2,1-2H3,(H2,31,32,33)(H,34,35,39)/t19-,25-,26-,29-/m0/s1 |
| InChIKey | JEDONVACSPCHPU-QVICYHPESA-N |
| XLogP | 4.59 |
| TPSA | 147.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|