C32H40N6O4 — CID 164730711
pentyl N-[7-[2-[(3aR,4S,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2,4-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]ethyl]quinolin-2-yl]carbamate (PubChem CID 164730711) has the molecular formula C32H40N6O4 and a molecular weight of 572.71 g/mol. Its IUPAC name is pentyl N-[7-[2-[(3aR,4S,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2,4-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]ethyl]quinolin-2-yl]carbamate.
| Compound Name | pentyl N-[7-[2-[(3aR,4S,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2,4-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]ethyl]quinolin-2-yl]carbamate |
|---|---|
| PubChem CID | 164730711 |
| Molecular Formula | C32H40N6O4 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | pentyl N-[7-[2-[(3aR,4S,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2,4-trimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]ethyl]quinolin-2-yl]carbamate |
| SMILES | CCCCCOC(=O)Nc1ccc2ccc(CC[C@@]3(C)CC(n4ccc5c(N)ncnc54)[C@@H]4OC(C)(C)O[C@@H]43)cc2n1 |
| InChI | InChI=1S/C32H40N6O4/c1-5-6-7-16-40-30(39)37-25-11-10-21-9-8-20(17-23(21)36-25)12-14-32(4)18-24(26-27(32)42-31(2,3)41-26)38-15-13-22-28(33)34-19-35-29(22)38/h8-11,13,15,17,19,24,26-27H,5-7,12,14,16,18H2,1-4H3,(H2,33,34,35)(H,36,37,39)/t24?,26-,27-,32-/m0/s1 |
| InChIKey | CCXZMLZMNYRMAP-YJNPTXNRSA-N |
| XLogP | 6.40 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|