C29H34N7O2+ — CID 155709033
2-[7-hydroxy-3-[4-(4-methylpiperazin-1-yl)anilino]-8-prop-2-ynyl-2,4-diaza-8-azoniabicyclo[4.2.0]octa-1,3,5-trien-8-yl]-8-methyl-6,7-dihydro-5H-quinolin-8-ol (PubChem CID 155709033) has the molecular formula C29H34N7O2+ and a molecular weight of 512.64 g/mol. Its IUPAC name is 2-[7-hydroxy-3-[4-(4-methylpiperazin-1-yl)anilino]-8-prop-2-ynyl-2,4-diaza-8-azoniabicyclo[4.2.0]octa-1,3,5-trien-8-yl]-8-methyl-6,7-dihydro-5H-quinolin-8-ol.
| Compound Name | 2-[7-hydroxy-3-[4-(4-methylpiperazin-1-yl)anilino]-8-prop-2-ynyl-2,4-diaza-8-azoniabicyclo[4.2.0]octa-1,3,5-trien-8-yl]-8-methyl-6,7-dihydro-5H-quinolin-8-ol |
|---|---|
| PubChem CID | 155709033 |
| Molecular Formula | C29H34N7O2+ |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 2-[7-hydroxy-3-[4-(4-methylpiperazin-1-yl)anilino]-8-prop-2-ynyl-2,4-diaza-8-azoniabicyclo[4.2.0]octa-1,3,5-trien-8-yl]-8-methyl-6,7-dihydro-5H-quinolin-8-ol |
| SMILES | C#CC[N+]1(c2ccc3c(n2)C(C)(O)CCC3)c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc2C1O |
| InChI | InChI=1S/C29H34N7O2/c1-4-18-36(24-12-7-20-6-5-13-29(2,38)25(20)32-24)26-23(27(36)37)19-30-28(33-26)31-21-8-10-22(11-9-21)35-16-14-34(3)15-17-35/h1,7-12,19,27,37-38H,5-6,13-18H2,2-3H3,(H,30,31,33)/q+1 |
| InChIKey | JVSIHQYYJAKVMA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|