C30H54N2O — CID 155709904
buta-1,3-diene;(E,7Z)-N-(3,4-dimethylpent-4-enyl)-N-(2-methoxyethyl)-5-methyl-7-(2-methylidenepiperidin-3-ylidene)hept-5-en-1-amine;ethane (PubChem CID 155709904) has the molecular formula C30H54N2O and a molecular weight of 458.78 g/mol. Its IUPAC name is buta-1,3-diene;(E,7Z)-N-(3,4-dimethylpent-4-enyl)-N-(2-methoxyethyl)-5-methyl-7-(2-methylidenepiperidin-3-ylidene)hept-5-en-1-amine;ethane.
| Compound Name | buta-1,3-diene;(E,7Z)-N-(3,4-dimethylpent-4-enyl)-N-(2-methoxyethyl)-5-methyl-7-(2-methylidenepiperidin-3-ylidene)hept-5-en-1-amine;ethane |
|---|---|
| PubChem CID | 155709904 |
| Molecular Formula | C30H54N2O |
| Molecular Weight | 458.78 g/mol |
| Exact Mass | 458.42 |
| IUPAC Name | buta-1,3-diene;(E,7Z)-N-(3,4-dimethylpent-4-enyl)-N-(2-methoxyethyl)-5-methyl-7-(2-methylidenepiperidin-3-ylidene)hept-5-en-1-amine;ethane |
| SMILES | C=C1NCCC/C1=C/C=C(\C)CCCCN(CCOC)CCC(C)C(=C)C.C=CC=C.CC |
| InChI | InChI=1S/C24H42N2O.C4H6.C2H6/c1-20(2)22(4)14-17-26(18-19-27-6)16-8-7-10-21(3)12-13-24-11-9-15-25-23(24)5;1-3-4-2;1-2/h12-13,22,25H,1,5,7-11,14-19H2,2-4,6H3;3-4H,1-2H2;1-2H3/b21-12+,24-13-;; |
| InChIKey | BLAHKZKZGGSUCS-XRSZVLTQSA-N |
| XLogP | 7.86 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.78 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|