C22H36N2O — CID 155710492
ethane;(1-methylcyclobutyl)-[4-[4-(2-methylpropyl)phenyl]piperazin-1-yl]methanone (PubChem CID 155710492) has the molecular formula C22H36N2O and a molecular weight of 344.54 g/mol. Its IUPAC name is ethane;(1-methylcyclobutyl)-[4-[4-(2-methylpropyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | ethane;(1-methylcyclobutyl)-[4-[4-(2-methylpropyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 155710492 |
| Molecular Formula | C22H36N2O |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | ethane;(1-methylcyclobutyl)-[4-[4-(2-methylpropyl)phenyl]piperazin-1-yl]methanone |
| SMILES | CC.CC(C)Cc1ccc(N2CCN(C(=O)C3(C)CCC3)CC2)cc1 |
| InChI | InChI=1S/C20H30N2O.C2H6/c1-16(2)15-17-5-7-18(8-6-17)21-11-13-22(14-12-21)19(23)20(3)9-4-10-20;1-2/h5-8,16H,4,9-15H2,1-3H3;1-2H3 |
| InChIKey | GEKFTDYBZXCLRK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|