About CID 155711195
CID 155711195 (PubChem CID 155711195) has the molecular formula C38H33BF2IN2O2-
and a molecular weight of 725.41 g/mol.
Molecular Properties
| Compound Name | CID 155711195 |
| PubChem CID | 155711195 |
| Molecular Formula | C38H33BF2IN2O2- |
| Molecular Weight | 725.41 g/mol |
| Exact Mass | 725.17 |
| IUPAC Name | — |
| SMILES | CC1=CC(C)=[N+]2[I-]C1=C(CCCC(=O)OCc1ccc3c4cccc5cccc(c6cccc1c63)c54)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C38H33BF2IN2O2/c1-22-19-25(4)44-39(40,41)43-24(3)20-23(2)38(43)33(37(22)42-44)15-8-16-34(45)46-21-27-17-18-32-30-13-6-10-26-9-5-12-29(35(26)30)31-14-7-11-28(27)36(31)32/h5-7,9-14,17-20H,8,15-16,21H2,1-4H3/q-1 |
| InChIKey | PRAFKUOQUPXXSP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 725.41 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 155711195 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155711195?
The IUPAC name of CID 155711195 (CID 155711195) is not available.
What is the SMILES notation for CID 155711195?
The canonical SMILES for CID 155711195 is CC1=CC(C)=[N+]2[I-]C1=C(CCCC(=O)OCc1ccc3c4cccc5cccc(c6cccc1c63)c54)c1c(C)cc(C)n1[B-]2(F)F.
What is the InChIKey of CID 155711195?
The InChIKey is PRAFKUOQUPXXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H33BF2IN2O2/c1-22-19-25(4)44-39(40,41)43-24(3)20-23(2)38(43)33(37(22)42-44)15-8-16-34(45)46-21-27-17-18-32-30-13-6-10-26-9-5-12-29(35(26)30)31-14-7-11-28(27)36(31)32/h5-7,9-14,17-20H,8,15-16,21H2,1-4H3/q-1.
What are the key properties of CID 155711195?
CID 155711195 has a molecular weight of 725.41 g/mol, XLogP of 6.45, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155711195 is sourced from PubChem (CID 155711195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).