C38H33BF2IN2O2- — CID 155711195
CID 155711195 (PubChem CID 155711195) has the molecular formula C38H33BF2IN2O2- and a molecular weight of 725.41 g/mol.
| Compound Name | CID 155711195 |
|---|---|
| PubChem CID | 155711195 |
| Molecular Formula | C38H33BF2IN2O2- |
| Molecular Weight | 725.41 g/mol |
| Exact Mass | 725.17 |
| IUPAC Name | — |
| SMILES | CC1=CC(C)=[N+]2[I-]C1=C(CCCC(=O)OCc1ccc3c4cccc5cccc(c6cccc1c63)c54)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C38H33BF2IN2O2/c1-22-19-25(4)44-39(40,41)43-24(3)20-23(2)38(43)33(37(22)42-44)15-8-16-34(45)46-21-27-17-18-32-30-13-6-10-26-9-5-12-29(35(26)30)31-14-7-11-28(27)36(31)32/h5-7,9-14,17-20H,8,15-16,21H2,1-4H3/q-1 |
| InChIKey | PRAFKUOQUPXXSP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 34.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.41 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|