C21H25N5O2S — CID 155711765
4-cyclopropyl-2-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,3-thiazole (PubChem CID 155711765) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is 4-cyclopropyl-2-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,3-thiazole.
| Compound Name | 4-cyclopropyl-2-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 155711765 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-cyclopropyl-2-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-1,3-thiazole |
| SMILES | COc1ccc(CN2CCn3c(-c4nc(C5CC5)cs4)nnc3[C@H]2C)c(OC)c1 |
| InChI | InChI=1S/C21H25N5O2S/c1-13-19-23-24-20(21-22-17(12-29-21)14-4-5-14)26(19)9-8-25(13)11-15-6-7-16(27-2)10-18(15)28-3/h6-7,10,12-14H,4-5,8-9,11H2,1-3H3/t13-/m1/s1 |
| InChIKey | LJRNAUQBRZJINZ-CYBMUJFWSA-N |
| XLogP | 3.87 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |