C20H25N5O2S — CID 71548645
4-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-2,5-dimethyl-1,3-thiazole (PubChem CID 71548645) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is 4-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-2,5-dimethyl-1,3-thiazole.
| Compound Name | 4-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-2,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 71548645 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-2,5-dimethyl-1,3-thiazole |
| SMILES | COc1ccc(CN2CCn3c(-c4nc(C)sc4C)nnc3[C@H]2C)c(OC)c1 |
| InChI | InChI=1S/C20H25N5O2S/c1-12-19-22-23-20(18-13(2)28-14(3)21-18)25(19)9-8-24(12)11-15-6-7-16(26-4)10-17(15)27-5/h6-7,10,12H,8-9,11H2,1-5H3/t12-/m1/s1 |
| InChIKey | LYFWURVTTSEJQL-GFCCVEGCSA-N |
| XLogP | 3.61 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |