C22H22FN5O2S — CID 162686449
2-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-6-fluoro-1,3-benzothiazole (PubChem CID 162686449) has the molecular formula C22H22FN5O2S and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-6-fluoro-1,3-benzothiazole.
| Compound Name | 2-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-6-fluoro-1,3-benzothiazole |
|---|---|
| PubChem CID | 162686449 |
| Molecular Formula | C22H22FN5O2S |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[(8R)-7-[(2,4-dimethoxyphenyl)methyl]-8-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-yl]-6-fluoro-1,3-benzothiazole |
| SMILES | COc1ccc(CN2CCn3c(-c4nc5ccc(F)cc5s4)nnc3[C@H]2C)c(OC)c1 |
| InChI | InChI=1S/C22H22FN5O2S/c1-13-20-25-26-21(22-24-17-7-5-15(23)10-19(17)31-22)28(20)9-8-27(13)12-14-4-6-16(29-2)11-18(14)30-3/h4-7,10-11,13H,8-9,12H2,1-3H3/t13-/m1/s1 |
| InChIKey | DVWVOLZLCSYRIO-CYBMUJFWSA-N |
| XLogP | 4.29 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |