C15H18ClFN2 — CID 155712591
N-[1-(7-chloro-5-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)ethenyl]prop-2-en-1-amine (PubChem CID 155712591) has the molecular formula C15H18ClFN2 and a molecular weight of 280.77 g/mol. Its IUPAC name is N-[1-(7-chloro-5-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)ethenyl]prop-2-en-1-amine.
| Compound Name | N-[1-(7-chloro-5-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)ethenyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 155712591 |
| Molecular Formula | C15H18ClFN2 |
| Molecular Weight | 280.77 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-[1-(7-chloro-5-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)ethenyl]prop-2-en-1-amine |
| SMILES | C=CCNC(=C)c1c(Cl)cc2c(c1F)CCN(C)C2 |
| InChI | InChI=1S/C15H18ClFN2/c1-4-6-18-10(2)14-13(16)8-11-9-19(3)7-5-12(11)15(14)17/h4,8,18H,1-2,5-7,9H2,3H3 |
| InChIKey | DAEKNPVEYMLYOU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.77 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|