C10H9N3O2S — CID 155712634
6-acetyl-5-methyl-2-sulfanylidene-1,8-dihydropyrido[2,3-d]pyrimidin-7-one (PubChem CID 155712634) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is 6-acetyl-5-methyl-2-sulfanylidene-1,8-dihydropyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-acetyl-5-methyl-2-sulfanylidene-1,8-dihydropyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 155712634 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 6-acetyl-5-methyl-2-sulfanylidene-1,8-dihydropyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC(=O)c1c(C)c2cnc(=S)[nH]c2[nH]c1=O |
| InChI | InChI=1S/C10H9N3O2S/c1-4-6-3-11-10(16)13-8(6)12-9(15)7(4)5(2)14/h3H,1-2H3,(H2,11,12,13,15,16) |
| InChIKey | CFRXFSYKIRHSFE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|