C22H20Cl2N4O3 — CID 155714454
3-(2,3-dichloroanilino)-2-[3-[[(2S)-oxetan-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 155714454) has the molecular formula C22H20Cl2N4O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is 3-(2,3-dichloroanilino)-2-[3-[[(2S)-oxetan-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 3-(2,3-dichloroanilino)-2-[3-[[(2S)-oxetan-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 155714454 |
| Molecular Formula | C22H20Cl2N4O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 3-(2,3-dichloroanilino)-2-[3-[[(2S)-oxetan-2-yl]methoxy]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | O=C1NCCc2[nH]c(-c3ccncc3OC[C@@H]3CCO3)c(Nc3cccc(Cl)c3Cl)c21 |
| InChI | InChI=1S/C22H20Cl2N4O3/c23-14-2-1-3-16(19(14)24)28-21-18-15(5-8-26-22(18)29)27-20(21)13-4-7-25-10-17(13)31-11-12-6-9-30-12/h1-4,7,10,12,27-28H,5-6,8-9,11H2,(H,26,29)/t12-/m0/s1 |
| InChIKey | FIHUXIWCQZUVOU-LBPRGKRZSA-N |
| XLogP | 4.58 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |